CAS 1251925-21-9
:Hydrazine, (2-methoxyphenyl)-, hydrochloride (1:2)
Description:
Hydrazine, (2-methoxyphenyl)-, hydrochloride (1:2) is a chemical compound characterized by its hydrazine backbone, which is a class of compounds known for their reducing properties and applications in various fields, including pharmaceuticals and agriculture. The presence of the 2-methoxyphenyl group contributes to its unique chemical behavior, potentially influencing its reactivity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for handling and formulation. This compound may exhibit biological activity, making it of interest in medicinal chemistry, though specific pharmacological properties would require further investigation. Safety data indicates that hydrazine derivatives can be hazardous, necessitating careful handling and storage. Overall, this compound's characteristics, including its molecular structure and solubility, make it a subject of interest in both research and industrial applications.
Formula:C7H10N2O·2ClH
InChI:InChI=1S/C7H10N2O.2ClH/c1-10-7-5-3-2-4-6(7)9-8;;/h2-5,9H,8H2,1H3;2*1H
InChI key:InChIKey=ZNIQFUSKKZCMMX-UHFFFAOYSA-N
SMILES:N(N)C1=C(OC)C=CC=C1.Cl
Synonyms:- Hydrazine, (2-methoxyphenyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
