CymitQuimica logo

CAS 1251925-41-3

:

4,5,6,7-Tetrahydro-2-(4-methylphenyl)-7-benzothiazolamine

Description:
4,5,6,7-Tetrahydro-2-(4-methylphenyl)-7-benzothiazolamine is a chemical compound characterized by its complex structure, which includes a benzothiazole moiety and a tetrahydro framework. This compound features a benzothiazole ring, which is known for its diverse biological activities, including antimicrobial and anticancer properties. The presence of the 4-methylphenyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The tetrahydro configuration indicates that the compound has a saturated cyclic structure, which may contribute to its stability and reactivity. In terms of solubility, compounds of this nature often exhibit moderate solubility in organic solvents, while their solubility in water can vary significantly based on the functional groups present. The compound's potential applications may span pharmaceuticals and agrochemicals, given the biological relevance of its structural components. However, specific data regarding its toxicity, environmental impact, and detailed biological activity would require further investigation and empirical studies.
Formula:C14H16N2S
InChI:InChI=1S/C14H16N2S/c1-9-5-7-10(8-6-9)14-16-12-4-2-3-11(15)13(12)17-14/h5-8,11H,2-4,15H2,1H3
InChI key:InChIKey=IRXJERWLIKJAGX-UHFFFAOYSA-N
SMILES:NC1C=2SC(=NC2CCC1)C3=CC=C(C)C=C3
Synonyms:
  • 7-Benzothiazolamine, 4,5,6,7-tetrahydro-2-(4-methylphenyl)-
  • 4,5,6,7-Tetrahydro-2-(4-methylphenyl)-7-benzothiazolamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.