CAS 1251950-60-3

Methyl 1-[2-(hydroxymethyl)phenyl]-5-methyl-1H-pyrazole-3-carboxylate

Description:

Methyl 1-[2-(hydroxymethyl)phenyl]-5-methyl-1H-pyrazole-3-carboxylate, identified by its CAS number 1251950-60-3, is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a carboxylate group, and a hydroxymethyl-substituted phenyl group. This compound typically exhibits properties associated with both pyrazole derivatives and carboxylic esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. The hydroxymethyl group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. Methyl esters like this compound are often studied for their biological activity, including potential applications in pharmaceuticals or agrochemicals. The presence of multiple functional groups suggests that it may exhibit diverse chemical reactivity, making it a candidate for further research in synthetic chemistry and medicinal applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₄N₂O₃

InChI: InChI=1S/C13H14N2O3/c1-9-7-11(13(17)18-2)14-15(9)12-6-4-3-5-10(12)8-16/h3-7,16H,8H2,1-2H3

InChI key: InChIKey=QUZWHXXMXVPCKC-UHFFFAOYSA-N

SMILES: CC=1N(N=C(C(OC)=O)C1)C2=C(CO)C=CC=C2

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 1-[2-(hydroxymethyl)phenyl]-5-methyl-, methyl ester
• Methyl 1-[2-(hydroxymethyl)phenyl]-5-methyl-1H-pyrazole-3-carboxylate