CymitQuimica logo

CAS 1251950-63-6

:

Spiro[piperidine-4,4′(5′H)-pyrrolo[1,2-a]quinoxaline], 8′-chloro-7′-methoxy-, hydrochloride (1:1)

Description:
Spiro[piperidine-4,4′(5′H)-pyrrolo[1,2-a]quinoxaline], 8′-chloro-7′-methoxy-, hydrochloride (1:1) is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both piperidine and pyrroloquinoxaline moieties. This compound features a chloro and a methoxy substituent, which can influence its biological activity and solubility. The hydrochloride form indicates that the compound is a salt, enhancing its stability and solubility in aqueous environments, which is often beneficial for pharmaceutical applications. The presence of multiple heteroatoms in its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and reactivity, would depend on the precise arrangement of atoms and the presence of functional groups. As with many compounds in this class, it may exhibit interesting pharmacological activities, warranting further investigation in drug development contexts. Safety and handling precautions should be observed due to the potential biological effects of the compound.
Formula:C16H18ClN3O.ClH
InChI:InChI=1S/C16H18ClN3O.ClH/c1-21-14-10-12-13(9-11(14)17)20-8-2-3-15(20)16(19-12)4-6-18-7-5-16;/h2-3,8-10,18-19H,4-7H2,1H3;1H
InChI key:InChIKey=KMMZPNGHIYOUIH-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2NC3(C=4N(C2=CC1Cl)C=CC4)CCNCC3.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.