
CAS 1251999-14-0
:4-Ethoxy-2,3-dihydro-1H-inden-1-amine
Description:
4-Ethoxy-2,3-dihydro-1H-inden-1-amine is an organic compound characterized by its unique bicyclic structure, which includes an indene framework with an ethoxy group and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the ethoxy group suggests moderate polarity, which can influence its solubility in various organic solvents. The amine functionality may impart basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Safety data should be consulted for handling and storage, as amines can be sensitive to oxidation and may pose health risks if inhaled or ingested.
Formula:C11H15NO
InChI:InChI=1S/C11H15NO/c1-2-13-11-5-3-4-8-9(11)6-7-10(8)12/h3-5,10H,2,6-7,12H2,1H3
InChI key:InChIKey=VCBRVXFVRIXQFC-UHFFFAOYSA-N
SMILES:O(CC)C1=C2C(C(N)CC2)=CC=C1
Synonyms:- 4-Ethoxy-2,3-dihydro-1H-inden-1-amine
- 1H-Inden-1-amine, 4-ethoxy-2,3-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.