
CAS 1252046-15-3
:1H-Benzimidazole-2-acetic acid, 6-chloro-, sodium salt (1:1)
Description:
1H-Benzimidazole-2-acetic acid, 6-chloro-, sodium salt (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. The presence of a chloro substituent at the 6-position enhances its reactivity and potential biological activity. As a sodium salt, it is typically more soluble in water compared to its acid form, which can facilitate its use in various applications, including pharmaceuticals and agrochemicals. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological effects would depend on the context of its use and concentration. The sodium salt form also suggests that it can dissociate in solution, releasing sodium ions, which may influence its behavior in biological systems. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry due to their diverse biological activities and potential therapeutic applications.
Formula:C9H7ClN2O2·Na
InChI:InChI=1S/C9H7ClN2O2.Na/c10-5-1-2-6-7(3-5)12-8(11-6)4-9(13)14;/h1-3H,4H2,(H,11,12)(H,13,14);
InChI key:InChIKey=PUSGWJXNTSWHJS-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1NC=2C(N1)=CC=C(Cl)C2.[Na]
Synonyms:- 1H-Benzimidazole-2-acetic acid, 6-chloro-, sodium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.