CymitQuimica logo

CAS 1252046-17-5

:

Pyrazino[1,2-a]indole, 1,2,3,4-tetrahydro-, compd. with methanesulfonate (1:1)

Description:
Pyrazino[1,2-a]indole, 1,2,3,4-tetrahydro-, compound with methanesulfonate (1:1), identified by CAS number 1252046-17-5, is a chemical compound that features a fused bicyclic structure comprising an indole and a pyrazine moiety. This compound is characterized by its tetrahydro form, indicating the presence of four hydrogen atoms that saturate the ring system, which can influence its reactivity and stability. The methanesulfonate component serves as a counterion, enhancing the solubility of the compound in various solvents and potentially affecting its biological activity. Pyrazino[1,2-a]indole derivatives are of interest in medicinal chemistry due to their potential pharmacological properties, including antitumor and antimicrobial activities. The specific interactions and mechanisms of action of this compound would depend on its structural features and the presence of functional groups. Overall, this compound represents a class of heterocyclic compounds that are valuable in drug discovery and development, warranting further investigation into its properties and applications.
Formula:C11H12N2·CH4O3S
InChI:InChI=1S/C11H12N2.CH4O3S/c1-2-4-11-9(3-1)7-10-8-12-5-6-13(10)11;1-5(2,3)4/h1-4,7,12H,5-6,8H2;1H3,(H,2,3,4)
InChI key:InChIKey=TZYZUFXTFMZQKR-UHFFFAOYSA-N
SMILES:C1=2N3C(=CC1=CC=CC2)CNCC3.S(C)(=O)(=O)O
Synonyms:
  • Methanesulfonic acid; 1,2,3,4-tetrahydropyrazino[1,2-a]indole
  • Pyrazino[1,2-a]indole, 1,2,3,4-tetrahydro-, compd. with methanesulfonate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.