CAS 125213-45-8
:(2Z)-(3-oxo-2-benzofuran-1(3H)-ylidene)ethanoic acid
Description:
(2Z)-(3-oxo-2-benzofuran-1(3H)-ylidene)ethanoic acid, with the CAS number 125213-45-8, is a chemical compound characterized by its unique structure that includes a benzofuran moiety and a ylidene functional group. This compound typically exhibits properties associated with both aromatic and carbonyl functionalities, which can influence its reactivity and interactions with other substances. It may display moderate solubility in organic solvents, while its acidic nature suggests it can participate in proton transfer reactions. The presence of the benzofuran ring contributes to its potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structure may allow for various substitution reactions, enabling the synthesis of derivatives with altered properties. Overall, this compound's characteristics make it a subject of interest for further research in organic synthesis and potential applications in pharmaceuticals.
Formula:C10H6O4
InChI:InChI=1/C10H6O4/c11-9(12)5-8-6-3-1-2-4-7(6)10(13)14-8/h1-5H,(H,11,12)/b8-5-
SMILES:c1ccc2c(c1)/C(=C/C(=O)O)/OC2=O
Synonyms:- (2Z)-(3-Oxo-2-benzofuran-1(3H)-ylidene)acetic acid
- acetic acid, 2-(3-oxo-1(3H)-isobenzofuranylidene)-, (2Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Acetic acid, 2-(3-oxo-1(3H)-isobenzofuranylidene)-, (2Z)-
CAS:Formula:C10H6O4Molecular weight:190.1522(2Z)-(3-oxo-2-Benzofuran-1(3H)-ylidene)ethanoic Acid
CAS:Controlled ProductFormula:C10H6O4Color and Shape:NeatMolecular weight:190.152

