CAS 12523-60-3
:difluoroboranyloxy-difluoro-borane
Description:
Difluoroboranyloxy-difluoro-borane, with the CAS number 12523-60-3, is a chemical compound that features boron and fluorine in its structure, indicating it is part of the boron-fluorine chemistry family. This substance typically exhibits characteristics associated with boron compounds, such as being a Lewis acid due to the electron-deficient nature of boron. The presence of difluoro groups suggests that it may have significant reactivity and volatility, as fluorinated compounds often display unique properties, including high electronegativity and stability against hydrolysis. The compound may also have applications in materials science and organic synthesis, particularly in reactions involving electrophilic boron species. Its physical state, solubility, and specific reactivity would depend on the conditions under which it is handled, including temperature and the presence of other reactants. Safety precautions are essential when working with such compounds due to their potential toxicity and reactivity. Overall, difluoroboranyloxy-difluoro-borane represents a specialized area of study within inorganic and organometallic chemistry.
Formula:B2F4O
InChI:InChI=1/B2F4O/c3-1(4)7-2(5)6
Synonyms:- Bis(difluoroboryl) oxide
- Tetrafluorodiboroxane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
