CAS 1252572-07-8

5-Bromo-2-fluoro-α,3-dimethylbenzenemethanol

Description:

5-Bromo-2-fluoro-α,3-dimethylbenzenemethanol is an organic compound characterized by the presence of a bromine atom and a fluorine atom attached to a dimethyl-substituted benzene ring, along with a hydroxymethyl group (-CH2OH). This compound belongs to the class of substituted phenols and is likely to exhibit properties typical of such compounds, including potential biological activity due to the presence of halogen substituents, which can influence reactivity and solubility. The dimethyl groups contribute to steric hindrance, potentially affecting the compound's interactions with other molecules. The hydroxymethyl group can participate in hydrogen bonding, enhancing solubility in polar solvents. The presence of both bromine and fluorine may also impart unique electronic properties, making it of interest in medicinal chemistry and materials science. As with many halogenated compounds, considerations regarding environmental impact and toxicity are important, particularly in terms of persistence and bioaccumulation. Overall, this compound's unique structure suggests potential applications in various chemical and pharmaceutical contexts.

Formula: C₉H₁₀BrFO

InChI: InChI=1S/C9H10BrFO/c1-5-3-7(10)4-8(6(2)12)9(5)11/h3-4,6,12H,1-2H3

InChI key: InChIKey=MBQKCFJCSQFOAM-UHFFFAOYSA-N

SMILES: C(C)(O)C1=C(F)C(C)=CC(Br)=C1

Synonyms:

• 5-Bromo-2-fluoro-α,3-dimethylbenzenemethanol
• Benzenemethanol, 5-bromo-2-fluoro-α,3-dimethyl-

Benzenemethanol, 5-bromo-2-fluoro-α,3-dimethyl-

CAS: 1252572-07-8

Formula: C₉H₁₀BrFO

Purity: 96%

Molecular weight: 233.0775

Ref: IN-DA01P1T7