CAS 1252572-34-1

Methyl 6-bromo-3H-imidazo[4,5-b]pyridine-2-carboxylate

Description:

Methyl 6-bromo-3H-imidazo[4,5-b]pyridine-2-carboxylate is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which incorporates a bromine atom at the 6-position and a methyl ester functional group at the 2-position. This compound typically exhibits a molecular formula that reflects its complex structure, featuring both nitrogen and bromine atoms, which contribute to its unique chemical reactivity and potential biological activity. The presence of the imidazole ring suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the methyl ester group can undergo hydrolysis, making it reactive in biological systems. Methyl 6-bromo-3H-imidazo[4,5-b]pyridine-2-carboxylate may be of interest in medicinal chemistry due to its potential pharmacological properties, particularly in the development of new therapeutic agents. Its solubility, stability, and reactivity can vary based on environmental conditions, making it a compound of interest for further research in both synthetic and applied chemistry.

Formula: C₈H₆BrN₃O₂

InChI: InChI=1S/C8H6BrN3O2/c1-14-8(13)7-11-5-2-4(9)3-10-6(5)12-7/h2-3H,1H3,(H,10,11,12)

InChI key: InChIKey=FDQVDKYOFQZHJG-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=NC=2C(N1)=CC(Br)=CN2

Synonyms:

• Methyl 6-bromo-3H-imidazo[4,5-b]pyridine-2-carboxylate
• 3H-Imidazo[4,5-b]pyridine-2-carboxylic acid, 6-bromo-, methyl ester