
CAS 125263-70-9
:3-Hydroxy-5-methoxy-6-methyl-2-pentyl-4H-pyran-4-one
Description:
3-Hydroxy-5-methoxy-6-methyl-2-pentyl-4H-pyran-4-one, with the CAS number 125263-70-9, is a chemical compound that belongs to the class of pyranones, which are characterized by a six-membered heterocyclic ring containing one oxygen atom. This particular compound features multiple functional groups, including a hydroxyl group (-OH), a methoxy group (-OCH3), and a pentyl side chain, contributing to its structural complexity and potential biological activity. The presence of these substituents suggests that it may exhibit various properties, such as solubility in organic solvents and potential interactions with biological systems. Pyranones are often studied for their pharmacological properties, including antioxidant and anti-inflammatory activities. The specific arrangement of substituents in this compound may influence its reactivity and interactions, making it of interest in medicinal chemistry and natural product research. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H18O4
InChI:InChI=1S/C12H18O4/c1-4-5-6-7-9-10(13)11(14)12(15-3)8(2)16-9/h13H,4-7H2,1-3H3
InChI key:InChIKey=OHRPDNHRQKOLGN-UHFFFAOYSA-N
SMILES:C(CCCC)C1=C(O)C(=O)C(OC)=C(C)O1
Synonyms:- 3-Hydroxy-5-methoxy-6-methyl-2-pentyl-4H-pyran-4-one
- Allixin
- 4H-Pyran-4-one, 3-hydroxy-5-methoxy-6-methyl-2-pentyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Allixin
CAS:Allixin, a garlic compound, weakly fights microbes and skin tumor growth; blocks toxin-induced mutations.Formula:C12H18O4Color and Shape:SolidMolecular weight:226.27

