CAS 125265-68-1
:Asiaticoside B
Description:
Asiaticoside B is a triterpenoid saponin primarily derived from the plant Centella asiatica, commonly known as Gotu Kola. This compound is recognized for its various pharmacological properties, including anti-inflammatory, antioxidant, and wound healing effects. Asiaticoside B exhibits a complex molecular structure characterized by a sugar moiety attached to a triterpenoid backbone, which contributes to its biological activity. It is often studied for its potential therapeutic applications in skin regeneration and cognitive enhancement. The compound is soluble in water and organic solvents, making it versatile for various formulations in herbal medicine and cosmetic products. Additionally, Asiaticoside B has been investigated for its role in promoting collagen synthesis and improving skin hydration, further highlighting its significance in dermatological applications. Its safety profile and efficacy continue to be explored in clinical and preclinical studies, emphasizing the importance of understanding its mechanisms of action and potential benefits in health and wellness.
Formula:C48H78O20
InChI:InChI=1S/C48H78O20/c1-20-28(53)30(55)33(58)40(64-20)67-36-25(17-49)65-39(35(60)32(36)57)63-18-26-29(54)31(56)34(59)41(66-26)68-42(62)48-12-10-43(2,3)14-22(48)21-8-9-27-44(4)15-24(52)38(61)45(5,19-50)37(44)23(51)16-47(27,7)46(21,6)11-13-48/h8,20,22-41,49-61H,9-19H2,1-7H3/t20-,22-,23+,24+,25+,26+,27+,28-,29+,30+,31-,32+,33+,34+,35+,36+,37+,38-,39+,40-,41-,44+,45-,46+,47+,48-/m0/s1
InChI key:InChIKey=NNWMHSNRRWMMBI-PJISEHJASA-N
SMILES:C(O[C@@H]1O[C@H](CO[C@@H]2O[C@H](CO)[C@@H](O[C@H]3[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O3)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]45[C@](C=6[C@@](C)(CC4)[C@@]7(C)[C@](CC6)([C@]8(C)[C@@]([C@H](O)C7)([C@@](CO)(C)[C@@H](O)[C@H](O)C8)[H])[H])(CC(C)(C)CC5)[H]
Synonyms:- Olean-12-en-28-oic acid, 2,3,6,23-tetrahydroxy-, O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl ester, (2α,3β,4α,6β)-
- Asiaticoside B
- Terminoloside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Asiaticoside B
CAS:Asiaticoside B is a triterpene glycoside isolated from Actaea asiatica. It has notable cytotoxicity against HepG2 and MCF-7 cancer cell lines.Formula:C48H78O20Purity:99.9%Color and Shape:SolidMolecular weight:975.12Terminoloside
CAS:Natural glycosideFormula:C48H78O20Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:975.12Asiaticoside B
CAS:Asiaticoside B is a natural saponin compound, which is extracted from the plant Centella asiatica. This compound predominantly acts through modulating collagen synthesis and activating fibroblasts, which are crucial for wound healing. Additionally, Asiaticoside B exhibits anti-inflammatory properties by inhibiting pro-inflammatory cytokines, thereby reducing inflammation at the cellular level.Formula:C48H78O20Purity:Min. 95%Color and Shape:PowderMolecular weight:975.12 g/mol






