CAS 1252672-36-8

4-[[(Phenylmethoxy)carbonyl]amino]bicyclo[2.2.1]heptane-1-carboxylic acid

Description:

4-[[(Phenylmethoxy)carbonyl]amino]bicyclo[2.2.1]heptane-1-carboxylic acid is a complex organic compound characterized by its bicyclic structure, which features a bicyclo[2.2.1]heptane framework. This compound contains multiple functional groups, including an amino group, a carboxylic acid group, and a phenylmethoxycarbonyl moiety, which contribute to its chemical reactivity and potential biological activity. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, while the amino group may engage in hydrogen bonding and nucleophilic reactions. The phenylmethoxy group adds lipophilicity, potentially influencing the compound's solubility and interaction with biological membranes. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its specific applications and behavior in biological systems would depend on its interactions with various targets, which could be explored through experimental studies.

Formula: C₁₆H₁₉NO₄

InChI: InChI=1S/C16H19NO4/c18-13(19)15-6-8-16(11-15,9-7-15)17-14(20)21-10-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,17,20)(H,18,19)

InChI key: InChIKey=YFIVNTSORJFXHM-UHFFFAOYSA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)C23CC(C(O)=O)(CC2)CC3

Synonyms:

• Bicyclo[2.2.1]heptane-1-carboxylic acid, 4-[[(phenylmethoxy)carbonyl]amino]-
• 4-[[(Phenylmethoxy)carbonyl]amino]bicyclo[2.2.1]heptane-1-carboxylic acid

4-(Benzyloxycarbonylamino)bicyclo[2.2.1]heptane-1-carboxylic acid

CAS: 1252672-36-8

Formula: C₁₆H₁₉NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 289.3264

Ref: IN-DA01F5NH

4-(Benzyloxycarbonylamino)bicyclo[2.2.1]heptane-1-carboxylic acid

CAS: 1252672-36-8

Formula: C₁₆H₁₉NO₄

Purity: 97%

Molecular weight: 289.331

Ref: 10-F096166