CAS 125279-72-3
:(-)-Lentiginosine
Description:
(-)-Lentiginosine is a naturally occurring alkaloid that belongs to the class of compounds known as indole alkaloids. It is primarily derived from certain plant species, particularly those in the genus *Lantana*. This compound is characterized by its chiral nature, existing as a specific enantiomer, which contributes to its biological activity. (-)-Lentiginosine has been studied for its potential pharmacological properties, including anti-inflammatory and anti-cancer effects, although further research is needed to fully understand its mechanisms of action and therapeutic potential. The compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many alkaloids. Its molecular structure features a complex arrangement of carbon, hydrogen, nitrogen, and oxygen atoms, contributing to its unique chemical properties. As with many natural products, the extraction and purification of (-)-Lentiginosine from plant sources can be challenging, necessitating advanced techniques in organic chemistry for its isolation and characterization.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c10-7-5-9-4-2-1-3-6(9)8(7)11/h6-8,10-11H,1-5H2/t6-,7-,8-/m1/s1
InChI key:InChIKey=SQECYPINZNWUTE-BWZBUEFSSA-N
SMILES:O[C@@H]1[C@@]2(N(C[C@H]1O)CCCC2)[H]
Synonyms:- (1R,2R,8aR)-1,2-Dihydroxyindolizidine
- (1R,2R,8aR)-Lentiginosine
- (1R,2R,8aR)-Octahydro-1,2-indolizinediol
- (1R,2R,8aR)-octahydroindolizine-1,2-diol
- 1,2-Indolizinediol, octahydro-, (1R,2R,8aR)-
- 1,2-Indolizinediol, octahydro-, [1R-(1α,2β,8aα)]-
- [1R-(1a,2,8aa)]-Octahydro-1,2-indolizinediol
- Lentiginosine, (-)-
- (-)-Lentiginosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(-)-Lentiginosine
CAS:Controlled ProductApplications A selective and powerful inhibitor of amyloglucosidases.
References Pastuszak, I., et al.: Biochemistry, 29, 1881 (1990), Chandra, K., et al.: J. Org. Chem., 67, 4630 (2002)Formula:C8H15NO2Color and Shape:NeatMolecular weight:157.21(-)-Lentiginosine
CAS:(-)-Lentiginosine is a natural iminosugar that serves as a potent glycosidase inhibitor. This compound is sourced primarily from a variety of plant species, where it occurs naturally as a secondary metabolite. The mode of action of (-)-lentiginosine involves the competitive inhibition of glycosidase enzymes, particularly α-glucosidases. By binding to these enzymes, it prevents the hydrolysis of glycosidic bonds, therefore impeding carbohydrate digestion and absorption processes.Formula:C8H15NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:157.21 g/molLentiginosine
CAS:Lentiginosine is a selective amyloglucosidase inhibitor.Formula:C8H15NO2Color and Shape:SolidMolecular weight:157.21



