CymitQuimica logo

CAS 1252807-00-3

:

N-[(1S,2R,3E)-1-[(β-D-Glucopyranosyloxy)methyl]-2-hydroxy-3-heptadecen-1-yl]heptadecanamide

Description:
N-[(1S,2R,3E)-1-[(β-D-Glucopyranosyloxy)methyl]-2-hydroxy-3-heptadecen-1-yl]heptadecanamide is a complex organic compound characterized by its long hydrocarbon chains and the presence of a glucopyranosyl moiety. This substance features a heptadecenyl group, indicating it has a 17-carbon chain with a double bond, which contributes to its unsaturation and potential reactivity. The glucopyranosyl group suggests that it is a glycosylated compound, which may enhance its solubility in water and biological activity due to the sugar component. The presence of hydroxyl (-OH) groups indicates potential for hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, the amide functional group suggests that it may participate in various chemical reactions, including hydrolysis and amidation. Overall, this compound's structure implies it may have applications in biochemistry, particularly in the study of lipid metabolism or as a potential bioactive molecule. Its specific characteristics would depend on its purity, stereochemistry, and the conditions under which it is studied.
Formula:C41H79NO8
InChI:InChI=1S/C41H79NO8/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-37(45)42-34(33-49-41-40(48)39(47)38(46)36(32-43)50-41)35(44)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h28,30,34-36,38-41,43-44,46-48H,3-27,29,31-33H2,1-2H3,(H,42,45)/b30-28+/t34-,35+,36+,38+,39-,40+,41+/m0/s1
InChI key:InChIKey=VQADGGHNXABKOV-VIBFQTAGSA-N
SMILES:O(C[C@@H]([C@@H](/C=C/CCCCCCCCCCCCC)O)NC(CCCCCCCCCCCCCCCC)=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Synonyms:
  • N-[(1S,2R,3E)-1-[(β-D-Glucopyranosyloxy)methyl]-2-hydroxy-3-heptadecen-1-yl]heptadecanamide
  • Heptadecanamide, N-[(1S,2R,3E)-1-[(β-D-glucopyranosyloxy)methyl]-2-hydroxy-3-heptadecen-1-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.