CAS 125291-15-8
:2-amino-9-(3-deoxy-3-fluoro-beta-D-xylofuranosyl)-3,9-dihydro-6H-purin-6-one
Description:
2-amino-9-(3-deoxy-3-fluoro-beta-D-xylofuranosyl)-3,9-dihydro-6H-purin-6-one, with CAS number 125291-15-8, is a purine derivative that exhibits structural features characteristic of nucleosides. This compound contains an amino group at the 2-position and a furanosyl sugar moiety, specifically a 3-deoxy-3-fluoro-beta-D-xylofuranosyl group, which contributes to its biological activity. The presence of the fluorine atom enhances its stability and may influence its interaction with biological targets. As a purine analog, it may play a role in nucleic acid metabolism and could potentially exhibit antiviral or anticancer properties. The dihydropurine structure suggests that it may exist in a tautomeric form, which can affect its reactivity and binding affinity. Overall, this compound's unique structural characteristics make it a subject of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents targeting nucleic acid processes.
Formula:C10H12FN5O4
InChI:InChI=1/C10H12FN5O4/c11-4-3(1-17)20-9(6(4)18)16-2-13-5-7(16)14-10(12)15-8(5)19/h2-4,6,9,17-18H,1H2,(H3,12,14,15,19)/t3-,4+,6-,9-/m1/s1
Synonyms:- 6H-Purin-6-one, 2-amino-9-(3-deoxy-3-fluoro-.beta.-D-xylofuranosyl)-1,9-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3'-Deoxy-3'-fluoro-xyloguanosine
CAS:<p>3'-Deoxy-3'-fluoro-xyloguanosine is a Nucleoside Derivative - Xylo-nucleoside, Fluoro-modified nucleoside, 3'-Modified nucleoside.</p>Formula:C10H12FN5O4Color and Shape:SolidMolecular weight:285.23
