CymitQuimica logo

CAS 125291-17-0

:

2'-Deoxy-2'-fluoro-D-guanosine

Description:
2'-Deoxy-2'-fluoro-D-guanosine is a modified nucleoside that features a fluorine atom at the 2' position of the ribose sugar, replacing the hydroxyl group typically found in natural nucleosides. This modification enhances the stability of the nucleoside against enzymatic degradation, making it of interest in medicinal chemistry and antiviral research. The compound retains the guanine base, which is crucial for its role in nucleic acid synthesis and function. Its structural characteristics contribute to its potential applications in the development of antiviral agents and in the study of nucleic acid interactions. Additionally, the presence of the fluorine atom can influence the compound's binding affinity and specificity towards nucleic acid targets. As a result, 2'-Deoxy-2'-fluoro-D-guanosine is often investigated for its therapeutic potential, particularly in the context of nucleoside analogs that can interfere with viral replication or cancer cell proliferation. Its unique properties make it a valuable compound in both research and pharmaceutical development.
Formula:C10H12FN5O3
InChI:InChI=1/C10H12FN5O3/c11-5-1-4(2-17)19-9(5)16-3-13-6-7(16)14-10(12)15-8(6)18/h3-5,9,17H,1-2H2,(H3,12,14,15,18)/t4-,5?,9+/m0/s1
Synonyms:
  • 2'-Fluoro-2',3'-Dideoxyguanosine
  • 2',3'-Dideoxy-3'-Fluoroguanosine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.