CAS 125292-34-4
:5-chloro-N-(1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine
Description:
5-Chloro-N-(1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine is a chemical compound characterized by its unique structure, which includes a benzothiadiazole core substituted with a chloro group and an imidazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the chloro and amine functional groups. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with antimicrobial or anticancer properties. The presence of the benzothiadiazole framework often contributes to its electronic properties, which can be leveraged in various applications, including dye synthesis and material science. Additionally, the imidazole ring can participate in hydrogen bonding and coordination chemistry, enhancing its potential utility in medicinal chemistry. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity, necessitating proper laboratory practices when working with this compound.
Formula:C9H6ClN5S
InChI:InChI=1/C9H6ClN5S/c10-5-1-2-6-8(15-16-14-6)7(5)13-9-11-3-4-12-9/h1-4H,(H2,11,12,13)
SMILES:c1cc2c(c(c1Cl)Nc1ncc[nH]1)nsn2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 6 products.
Dehydro Tizanidine
CAS:Controlled ProductApplications A metabolite of Tizanidine (M-5).
References Sarkar, M., et al.: Drug Metab. Dispos., 20, 31 (1992), Greiner, B., et al.: J. Clin. Invest., 104, 147 (1999), Kyrklund, C., et al.: Clin. Pharmacol. Ther., 68, 592 (2000), Tirona, R., et al.: J. Pharm. Sci., 94, 1169 (2005),Formula:C9H6ClN5SColor and Shape:NeatMolecular weight:251.7Dehydro Tizanidine-13C3, 15N
CAS:Controlled ProductFormula:C3C6H6Cl15NN4SColor and Shape:NeatMolecular weight:255.667
