CymitQuimica logo

CAS 125298-97-7

:

(3,4-DIMETHYL-PHENOXY)-ACETIC ACID HYDRAZIDE

Description:
(3,4-Dimethyl-phenoxy)-acetic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from the reaction of hydrazine with (3,4-dimethyl-phenoxy)-acetic acid. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, including potential biological activity. It may be soluble in organic solvents and exhibit moderate stability under standard conditions. The presence of the dimethyl and phenoxy groups can influence its reactivity and interaction with biological systems, potentially making it of interest in pharmaceutical applications. Additionally, compounds of this nature may be studied for their herbicidal or fungicidal properties, as the phenoxyacetic acid derivatives are often linked to plant growth regulation. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Further characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry would provide more detailed insights into its structure and properties.
Formula:C10H14N2O2
InChI:InChI=1/C10H14N2O2/c1-7-3-4-9(5-8(7)2)14-6-10(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13)
SMILES:Cc1ccc(cc1C)OCC(=NN)O
Synonyms:
  • Acetic Acid, 2-(3,4-Dimethylphenoxy)-, Hydrazide
  • 2-(3,4-Dimethylphenoxy)Acetohydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.