CymitQuimica logo

CAS 1253123-65-7

:

1,2-Dibromo-1-[(trifluoromethyl)sulfinyl]ethane

Description:
1,2-Dibromo-1-[(trifluoromethyl)sulfinyl]ethane is a chemical compound characterized by the presence of two bromine atoms and a trifluoromethylsulfinyl group attached to a two-carbon ethane backbone. This compound features a sulfinyl functional group, which typically imparts unique reactivity and properties due to the presence of sulfur and oxygen. The bromine atoms contribute to its potential as a halogenated compound, which can influence its reactivity, stability, and interactions with other substances. The trifluoromethyl group is known for enhancing lipophilicity and can significantly affect the compound's biological activity and environmental behavior. This compound may be of interest in various fields, including organic synthesis, agrochemicals, and materials science, due to its unique structural features. However, specific safety and handling guidelines should be followed, as halogenated compounds can pose environmental and health risks. As with any chemical, understanding its properties, reactivity, and potential applications is crucial for safe and effective use.
Formula:C3H3Br2F3OS
InChI:InChI=1S/C3H3Br2F3OS/c4-1-2(5)10(9)3(6,7)8/h2H,1H2
InChI key:InChIKey=ZYGJMEPSZYHFHV-UHFFFAOYSA-N
SMILES:S(C(F)(F)F)(C(CBr)Br)=O
Synonyms:
  • 1,2-Dibromo-1-[(trifluoromethyl)sulfinyl]ethane
  • Ethane, 1,2-dibromo-1-[(trifluoromethyl)sulfinyl]-
  • 1,2-Dibromo-1-trifluoromethanesulfinylethane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.