CAS 125313-92-0: 3-(1-Methyl-1H-indol-3-yl)-4-(1-methyl-6-nitro-1H-indol-3-yl)-1H-pyrrole-2,5-dione

Description:3-(1-Methyl-1H-indol-3-yl)-4-(1-methyl-6-nitro-1H-indol-3-yl)-1H-pyrrole-2,5-dione, with CAS number 125313-92-0, is a synthetic organic compound characterized by its complex structure, which includes indole and pyrrole moieties. This compound features a pyrrole-2,5-dione core, which is known for its reactivity and potential biological activity. The presence of methyl and nitro substituents on the indole rings suggests that it may exhibit unique electronic properties and could participate in various chemical reactions. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological significance of indole derivatives. Additionally, its solubility, stability, and reactivity can vary based on the specific conditions, such as pH and solvent, making it a subject of interest for further research in organic synthesis and drug development. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity in organic chemistry.

Formula:C₂₂H₁₆N₄O₄

InChI:InChI=1S/C22H16N4O4/c1-24-10-15(13-5-3-4-6-17(13)24)19-20(22(28)23-21(19)27)16-11-25(2)18-9-12(26(29)30)7-8-14(16)18/h3-11H,1-2H3,(H,23,27,28)

InChI key:InChIKey=OVSKGTONMLKNPZ-UHFFFAOYSA-N

SMILES:O=C1NC(=O)C(C2=CN(C=3C=C(C=CC23)N(=O)=O)C)=C1C4=CN(C=5C=CC=CC45)C

Synonyms:
3-(1-Methyl-1H-indol-3-yl)-4-(1-methyl-6-nitro-1H-indol-3-yl)-1H-pyrrole-2,5-dione
Ro 31-7453
1H-Pyrrole-2,5-dione, 3-(1-methyl-1H-indol-3-yl)-4-(1-methyl-6-nitro-1H-indol-3-yl)-
MKC 1
R 440

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	1H-Pyrrole-2,5-dione, 3-(1-methyl-1H-indol-3-yl)-4-(1-methyl-6-nitro-1H-indol-3-yl)- REF: IN-DA000NHICAS: 125313-92-0	95%	To inquire	Mon 07 Apr 25
	MKC-1 REF: TM-T9831CAS: 125313-92-0	98.38% - 99.46%	To inquire	Tue 08 Apr 25