CAS 1253180-94-7
:Methyl (2E)-3-(2,6-difluorophenyl)-2-propenoate
Description:
Methyl (2E)-3-(2,6-difluorophenyl)-2-propenoate is an organic compound characterized by its structure, which includes a methyl ester functional group and a conjugated double bond system. The presence of the 2,6-difluorophenyl group introduces significant polarity and influences the compound's reactivity and solubility. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is likely to be soluble in organic solvents like ethanol and dichloromethane, while being less soluble in water due to its hydrophobic characteristics. The difluorophenyl substituent can enhance the compound's biological activity and stability, making it of interest in pharmaceutical and agrochemical applications. Additionally, the (2E) configuration indicates that the double bond is in the trans configuration, which can affect the compound's geometric isomerism and overall reactivity. Safety data should be consulted for handling and potential hazards associated with this compound, as with any chemical substance.
Formula:C10H8F2O2
InChI:InChI=1S/C10H8F2O2/c1-14-10(13)6-5-7-8(11)3-2-4-9(7)12/h2-6H,1H3/b6-5+
InChI key:InChIKey=AAFOYRAHPCQEFT-AATRIKPKSA-N
SMILES:C(=C/C(OC)=O)\C1=C(F)C=CC=C1F
Synonyms:- Methyl (2E)-3-(2,6-difluorophenyl)-2-propenoate
- 2-Propenoic acid, 3-(2,6-difluorophenyl)-, methyl ester, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
