
CAS 125319-03-1
:3-[[Hydroxy[[(2-phenylacetyl)amino]methyl]phosphinyl]oxy]benzoic acid
Description:
3-[[Hydroxy[[(2-phenylacetyl)amino]methyl]phosphinyl]oxy]benzoic acid, with the CAS number 125319-03-1, is a chemical compound characterized by its complex structure that includes a benzoic acid moiety, a phosphinyl group, and a phenylacetylamino side chain. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the phosphinyl group, which can participate in various chemical reactions. It is likely to be soluble in polar solvents, given the presence of hydroxyl and carboxylic acid groups, while its aromatic components may contribute to hydrophobic interactions. The compound may also exhibit biological activity, potentially acting as an inhibitor or modulator in biochemical pathways, although specific biological properties would require empirical investigation. Overall, its unique structure suggests potential applications in medicinal chemistry or as a biochemical probe, but further studies would be necessary to elucidate its full range of characteristics and functionalities.
Formula:C16H16NO6P
InChI:InChI=1S/C16H16NO6P/c18-15(9-12-5-2-1-3-6-12)17-11-24(21,22)23-14-8-4-7-13(10-14)16(19)20/h1-8,10H,9,11H2,(H,17,18)(H,19,20)(H,21,22)
InChI key:InChIKey=PQNMYMXNEUQFAJ-UHFFFAOYSA-N
SMILES:O(P(CNC(CC1=CC=CC=C1)=O)(=O)O)C2=CC(C(O)=O)=CC=C2
Synonyms:- Benzoic acid, 3-[[hydroxy[[(phenylacetyl)amino]methyl]phosphinyl]oxy]-
- Benzoic acid, 3-[[hydroxy[[(2-phenylacetyl)amino]methyl]phosphinyl]oxy]-
- 3-[[Hydroxy[[(2-phenylacetyl)amino]methyl]phosphinyl]oxy]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzoic acid, 3-[[hydroxy[[(2-phenylacetyl)amino]methyl]phosphinyl]oxy]-
CAS:Formula:C16H16NO6PMolecular weight:349.2751
