CAS 1253200-93-9

1,1-Dimethylethyl 5-(aminocarbonyl)-2-methyl-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 5-(aminocarbonyl)-2-methyl-1-piperidinecarboxylate, identified by its CAS number 1253200-93-9, is a chemical compound that features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound is characterized by the presence of an aminocarbonyl group, indicating that it has an amine functional group attached to a carbonyl, contributing to its potential reactivity and biological activity. The dimethyl substituents on the ethyl group suggest steric hindrance, which may influence its interaction with biological targets or its solubility in various solvents. The presence of the carboxylate group implies that it may exhibit acidic properties, potentially participating in acid-base reactions. Overall, this compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for the development of pharmaceuticals or agrochemicals. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for comprehensive characterization.

Formula: C₁₂H₂₂N₂O₃

InChI: InChI=1S/C12H22N2O3/c1-8-5-6-9(10(13)15)7-14(8)11(16)17-12(2,3)4/h8-9H,5-7H2,1-4H3,(H2,13,15)

InChI key: InChIKey=UJNWAYNHIHBWJD-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(C(N)=O)CCC1C

Synonyms:

• 1,1-Dimethylethyl 5-(aminocarbonyl)-2-methyl-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 5-(aminocarbonyl)-2-methyl-, 1,1-dimethylethyl ester