CymitQuimica logo

CAS 1253282-56-2

:

4-[(Phenylmethoxy)amino]-1-butanol

Description:
4-[(Phenylmethoxy)amino]-1-butanol, identified by its CAS number 1253282-56-2, is an organic compound characterized by the presence of both an amino group and a hydroxyl group, which contribute to its potential as a versatile building block in organic synthesis. This compound features a butanol backbone, with a phenylmethoxy group attached to the amino nitrogen, enhancing its solubility and reactivity. The presence of the phenyl group may impart aromatic characteristics, influencing its interactions and stability in various chemical environments. Typically, compounds of this nature may exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, affecting their physical properties such as boiling and melting points. Additionally, the amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and other organic materials. Its specific applications and behavior would depend on the context of its use, including the presence of other functional groups and the overall molecular environment.
Formula:C11H17NO2
InChI:InChI=1S/C11H17NO2/c13-9-5-4-8-12-14-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10H2
InChI key:InChIKey=MOGXGNSQHVJDQP-UHFFFAOYSA-N
SMILES:C(ONCCCCO)C1=CC=CC=C1
Synonyms:
  • 4-[(Phenylmethoxy)amino]-1-butanol
  • 1-Butanol, 4-[(phenylmethoxy)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.