CAS 125366-29-2
:5'-4-(fluorosulfonyl)benzoyl-8-azidoadenosine
Description:
5'-4-(Fluorosulfonyl)benzoyl-8-azidoadenosine is a chemical compound that belongs to the class of nucleoside analogs, specifically modified adenosine derivatives. This compound features a benzoyl group substituted at the 5' position of the ribose sugar, along with a fluorosulfonyl group at the para position of the benzoyl moiety. The presence of the azido group at the 8-position of the adenine base introduces unique reactivity, making it useful in various biochemical applications, including bioconjugation and labeling studies. The fluorosulfonyl group is known for its electrophilic properties, which can facilitate reactions with nucleophiles. This compound is of interest in medicinal chemistry and molecular biology due to its potential role in the development of therapeutic agents and probes for studying biological processes. Its specific reactivity and structural features make it a valuable tool in research settings, particularly in the fields of drug development and chemical biology. As with many chemical substances, handling and usage should be conducted with appropriate safety measures due to potential hazards associated with its reactive functional groups.
Formula:C17H15FN8O7S
InChI:InChI=1/C17H15FN8O7S/c18-34(30,31)8-3-1-7(2-4-8)16(29)32-5-9-11(27)12(28)15(33-9)26-14-10(13(19)21-6-22-14)23-17(26)24-25-20/h1-4,6,9,11-12,15,27-28H,5H2,(H2,19,21,22)/t9-,11-,12-,15-/m1/s1
SMILES:c1cc(ccc1C(=O)OC[C@@H]1[C@H]([C@H]([C@H](n2c3c(c(N)ncn3)nc2N=[N+]=[NH-])O1)O)O)S(=O)(=O)F
Synonyms:- 5'-(Para-Fluorosulfonyl)Benzoyl-8-Azidoadenosine
- 5'-Fsbaza
- 8-Azidoadenosine 5'-(4-(fluorosulfonyl)benzoate)
- Adenosine, 8-azido-, 5'-(4-(fluorosulfonyl)benzoate)
- 8-azido-5'-O-[4-(fluorosulfonyl)benzoyl]adenosine
- 5'-(4-Fluorosulfonyl)benzoyl-8-azidoadenosine
- 5'-4-(Fluorosulfonyl)benzoyl-8-azidoadenosine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.