CAS 1253696-29-5

Methyl 5-formylfuro[2,3-b]pyridine-2-carboxylate

Description:

Methyl 5-formylfuro[2,3-b]pyridine-2-carboxylate is a chemical compound characterized by its complex structure, which includes a furo[2,3-b]pyridine core, a formyl group, and a carboxylate ester functionality. This compound typically exhibits a range of chemical properties due to the presence of multiple functional groups, which can influence its reactivity and solubility. It is likely to be a polar organic molecule, making it soluble in polar solvents such as methanol or ethanol. The presence of the formyl group suggests potential reactivity in condensation reactions, while the carboxylate moiety may participate in acid-base chemistry. Additionally, the furo[2,3-b]pyridine structure can contribute to its biological activity, potentially making it of interest in medicinal chemistry. The compound's unique features may also allow for applications in organic synthesis or as a building block in the development of more complex molecules. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₁₀H₇NO₄

InChI: InChI=1S/C10H7NO4/c1-14-10(13)8-3-7-2-6(5-12)4-11-9(7)15-8/h2-5H,1H3

InChI key: InChIKey=SIIHDKRSMFKILO-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC=2C(O1)=NC=C(C=O)C2

Synonyms:

• Furo[2,3-b]pyridine-2-carboxylic acid, 5-formyl-, methyl ester
• Methyl 5-formylfuro[2,3-b]pyridine-2-carboxylate