CAS 125372-29-4

2-Azido-3,4-dimethylimidazo[4,5-f]quinoline

Description:

2-Azido-3,4-dimethylimidazo[4,5-f]quinoline is a heterocyclic compound characterized by its complex structure, which includes an imidazoquinoline core with azido and methyl substituents. This compound is notable for its potential biological activity, particularly in the context of mutagenicity and carcinogenicity studies, as it belongs to a class of compounds known for their ability to form DNA adducts. The azido group (-N3) is a key feature, contributing to its reactivity and potential applications in click chemistry and bioconjugation. The presence of methyl groups at the 3 and 4 positions of the imidazoquinoline ring can influence its solubility, stability, and interaction with biological targets. Additionally, the compound's unique structure may exhibit fluorescence properties, making it of interest in various research fields, including medicinal chemistry and material science. Safety considerations are paramount when handling this compound due to its potential reactivity and biological implications.

Formula: C₁₂H₁₀N₆

InChI: InChI=1/C12H10N6/c1-7-6-9-8(4-3-5-14-9)10-11(7)18(2)12(15-10)16-17-13/h3-6H,1-2H3

SMILES: Cc1cc2c(cccn2)c2c1n(C)c(n2)N=[N+]=[NH-]

Synonyms:

• Azido-meiq
• Azido-methyl-IQ
• Ccris 3680
• 2-azido-3,4-dimethyl-3H-imidazo[4,5-f]quinoline

2-Azido-3,4-dimethylimidazo[4,5-f]quinoline

CAS: 125372-29-4

Formula: C₁₂H₁₀N₆

Color and Shape: Solid

Molecular weight: 238.248

Ref: IN-DA000NKD

2-Azido-3,4-dimethylimidazo[4,5f]quinoline

CAS: 125372-29-4

2-Azido-3,4-dimethylimidazo[4,5f]quinoline

Purity: ≥95%

Ref: 54-OR8450T

2-Azido-3,4-dimethylimidazo[4,5-f]quinoline

CAS: 125372-29-4

Applications A novel analogue of the food mutagen and carcinogen MeIQ.
References Kerdar, R., et al.: Toxicol. Lett., 67, 73 (1993),

Formula: C₁₂H₁₀N₆

Color and Shape: Pale Red to Light Red Solid

Molecular weight: 238.25

Ref: TR-A845000