
CAS 125372-33-0
:(3R)-3-(3-Pyridinyl)-1H,3H-pyrrolo[1,2-c]thiazole-7-carboxamide
Description:
(3R)-3-(3-Pyridinyl)-1H,3H-pyrrolo[1,2-c]thiazole-7-carboxamide is a chemical compound characterized by its complex heterocyclic structure, which includes a pyridine ring and a thiazole moiety fused with a pyrrole. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the carboxamide functional group suggests it may engage in hydrogen bonding, influencing its interaction with biological targets. Its stereochemistry, indicated by the (3R) designation, implies specific spatial arrangements that can affect its pharmacological properties. Compounds like this are often investigated for their potential therapeutic applications, particularly in areas such as oncology or neurology, due to their ability to modulate biological pathways. The CAS number 125372-33-0 uniquely identifies this substance, facilitating its recognition in scientific literature and databases. Overall, this compound represents a class of molecules that may hold promise for drug development, pending further research into its efficacy and safety profiles.
Formula:C12H11N3OS
InChI:InChI=1S/C12H11N3OS/c13-11(16)9-3-5-15-10(9)7-17-12(15)8-2-1-4-14-6-8/h1-6,12H,7H2,(H2,13,16)/t12-/m1/s1
InChI key:InChIKey=ARFOASMERCHFBY-GFCCVEGCSA-N
SMILES:C(N)(=O)C1=C2N([C@H](SC2)C=3C=CC=NC3)C=C1
Synonyms:- Dacopafant
- 1H,3H-Pyrrolo[1,2-c]thiazole-7-carboxamide, 3-(3-pyridinyl)-, (R)-
- (3R)-3-(3-Pyridinyl)-1H,3H-pyrrolo[1,2-c]thiazole-7-carboxamide
- RP 55778
- 1H,3H-Pyrrolo[1,2-c]thiazole-7-carboxamide, 3-(3-pyridinyl)-, (3R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dacopafant
CAS:Dacopafant is an antagonist of platlet activationg factor receptor.Formula:C12H11N3OSColor and Shape:SolidMolecular weight:245.3
