CymitQuimica logo

CAS 125376-12-7

:

Phosphoramidic acid, [(benzoylamino)methyl]-, dimethyl ester

Description:
Phosphoramidic acid, [(benzoylamino)methyl]-, dimethyl ester, identified by CAS number 125376-12-7, is a chemical compound that features a phosphoramidic acid backbone modified with a benzoylamino group and two methyl ester functionalities. This compound is characterized by its phosphorous atom, which is typically in a +5 oxidation state, bonded to an amine and ester groups, contributing to its reactivity and potential applications in organic synthesis and as a reagent in various chemical reactions. The presence of the benzoylamino group suggests that it may exhibit properties associated with aromatic compounds, such as stability and potential for further functionalization. Additionally, the dimethyl ester groups can influence its solubility and reactivity, making it suitable for use in various chemical processes. Overall, this compound may be of interest in fields such as medicinal chemistry, agrochemicals, or materials science, where phosphoramidic derivatives are explored for their biological activity or as intermediates in synthetic pathways.
Formula:C10H15N2O4P
InChI:InChI=1S/C10H15N2O4P/c1-15-17(14,16-2)12-8-11-10(13)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,11,13)(H,12,14)
InChI key:InChIKey=DEFLBCGZEAJZOQ-UHFFFAOYSA-N
SMILES:C(NCNP(OC)(OC)=O)(=O)C1=CC=CC=C1
Synonyms:
  • Phosphoramidic acid, [(benzoylamino)methyl]-, dimethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.