
CAS 1253789-11-5
:7-Methyl-1-propyl-2H-pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione
Description:
7-Methyl-1-propyl-2H-pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyridine and an oxazine moiety. This compound features a methyl group and a propyl group as substituents, contributing to its unique chemical properties. The presence of the oxazine ring indicates potential reactivity, particularly in nucleophilic or electrophilic reactions. The dione functional groups suggest that it may exhibit keto-enol tautomerism, influencing its reactivity and stability. Additionally, the compound's structure may impart specific biological activities, making it of interest in medicinal chemistry. Its molecular interactions could be influenced by the steric and electronic effects of the substituents, which may affect solubility and bioavailability. As with many heterocycles, the compound may also exhibit interesting optical properties, potentially making it useful in various applications, including pharmaceuticals and materials science. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H12N2O3
InChI:InChI=1S/C11H12N2O3/c1-3-6-13-9-8(5-4-7(2)12-9)10(14)16-11(13)15/h4-5H,3,6H2,1-2H3
InChI key:InChIKey=CPDARBAVHVULKD-UHFFFAOYSA-N
SMILES:C(CC)N1C=2C(C(=O)OC1=O)=CC=C(C)N2
Synonyms:- 2H-Pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione, 7-methyl-1-propyl-
- 7-Methyl-1-propyl-2H-pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.