CAS 1253789-16-0
:3-(1,1-Dimethylethyl) 3,4-oxazolidinedicarboxylate
Description:
3-(1,1-Dimethylethyl) 3,4-oxazolidinedicarboxylate is a chemical compound characterized by its oxazolidine ring structure, which incorporates two carboxylate functional groups. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, influencing its reactivity and solubility. The oxazolidine ring is a five-membered heterocycle containing both nitrogen and oxygen, which can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The presence of the carboxylate groups enhances its potential for forming salts and participating in acid-base reactions. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of solvents. Overall, 3-(1,1-Dimethylethyl) 3,4-oxazolidinedicarboxylate is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C9H15NO5
InChI:InChI=1S/C9H15NO5/c1-9(2,3)15-8(13)10-5-14-4-6(10)7(11)12/h6H,4-5H2,1-3H3,(H,11,12)
InChI key:InChIKey=LFAOMDJJZKWOPH-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(C(O)=O)COC1
Synonyms:- 3-(1,1-Dimethylethyl) 3,4-oxazolidinedicarboxylate
- 3-[(tert-Butoxy)carbonyl]-1,3-oxazolidine-4-carboxylic acid
- 3,4-Oxazolidinedicarboxylic acid, 3-(1,1-dimethylethyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,4-Oxazolidinedicarboxylic Acid 3-(1,1-Dimethylethyl) Ester
CAS:Formula:C9H15NO5Molecular weight:217.21913,4-Oxazolidinedicarboxylic Acid 3-(1,1-Dimethylethyl) Ester
CAS:Controlled ProductFormula:C9H15NO5Color and Shape:NeatMolecular weight:217.22

