CAS 1253790-04-3

Ethyl 1,2-dihydro-4-hydroxy-1-(2-methoxyethyl)-2-oxo-1,8-naphthyridine-3-carboxylate

Description:

Ethyl 1,2-dihydro-4-hydroxy-1-(2-methoxyethyl)-2-oxo-1,8-naphthyridine-3-carboxylate is a chemical compound characterized by its complex structure, which includes a naphthyridine core, a carboxylate group, and an ethyl ester functionality. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, including antimicrobial or anti-inflammatory effects, due to the presence of the naphthyridine moiety. The hydroxyl group contributes to its solubility in polar solvents, while the methoxyethyl substituent may enhance lipophilicity, influencing its pharmacokinetic properties. The compound's structure suggests it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Its specific applications and reactivity would depend on further studies, including its interaction with biological targets or its role in synthetic pathways. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₄H₁₆N₂O₅

InChI: InChI=1S/C14H16N2O5/c1-3-21-14(19)10-11(17)9-5-4-6-15-12(9)16(13(10)18)7-8-20-2/h4-6,17H,3,7-8H2,1-2H3

InChI key: InChIKey=UPIOHCLYCSXZGP-UHFFFAOYSA-N

SMILES: C(COC)N1C=2C(C(O)=C(C(OCC)=O)C1=O)=CC=CN2

Synonyms:

• 1,8-Naphthyridine-3-carboxylic acid, 1,2-dihydro-4-hydroxy-1-(2-methoxyethyl)-2-oxo-, ethyl ester
• Ethyl 1,2-dihydro-4-hydroxy-1-(2-methoxyethyl)-2-oxo-1,8-naphthyridine-3-carboxylate