
CAS 1253790-97-4
:6,7-Dihydro-4H-pyrazolo[5,1-c][1,4]thiazine-2-carboxylic acid
Description:
6,7-Dihydro-4H-pyrazolo[5,1-c][1,4]thiazine-2-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and thiazine moieties. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of nitrogen and sulfur atoms within its structure imparts distinctive chemical properties, influencing its behavior in various chemical reactions and interactions. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular framework allows for potential hydrogen bonding and coordination with metal ions, which can be relevant in catalysis or as ligands in coordination chemistry. Additionally, the compound's solubility and stability can vary based on environmental conditions, such as pH and temperature. Overall, 6,7-Dihydro-4H-pyrazolo[5,1-c][1,4]thiazine-2-carboxylic acid represents a class of compounds that may have diverse applications in pharmaceuticals and materials science.
Formula:C7H8N2O2S
InChI:InChI=1S/C7H8N2O2S/c10-7(11)6-3-5-4-12-2-1-9(5)8-6/h3H,1-2,4H2,(H,10,11)
InChI key:InChIKey=BJUYJGVDNAZBDZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2N(N1)CCSC2
Synonyms:- 4H-Pyrazolo[5,1-c][1,4]thiazine-2-carboxylic acid, 6,7-dihydro-
- 6,7-Dihydro-4H-pyrazolo[5,1-c][1,4]thiazine-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.