
CAS 1253791-14-8
:Propanedioic acid, 2-[(4-bromophenyl)methyl]-2-methyl-
Description:
Propanedioic acid, 2-[(4-bromophenyl)methyl]-2-methyl- is an organic compound characterized by its structure, which includes a propanedioic acid backbone with a 4-bromobenzyl group and a methyl substituent. This compound features two carboxylic acid functional groups, which contribute to its acidity and potential reactivity. The presence of the bromine atom in the phenyl ring enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The methyl group at the second position of the propanedioic acid adds steric hindrance, influencing its reactivity and solubility. This compound may exhibit properties typical of both carboxylic acids and aromatic compounds, such as solubility in polar solvents and potential for hydrogen bonding. Its applications could range from pharmaceuticals to agrochemicals, depending on its specific reactivity and functionalization potential. As with many organic compounds, safety and handling precautions should be observed due to its chemical nature and potential biological effects.
Formula:C11H11BrO4
InChI:InChI=1S/C11H11BrO4/c1-11(9(13)14,10(15)16)6-7-2-4-8(12)5-3-7/h2-5H,6H2,1H3,(H,13,14)(H,15,16)
InChI key:InChIKey=VWKFNGVIAYPBRC-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(Br)C=C1)(C(O)=O)(C(O)=O)C
Synonyms:- 2-(4-Bromo-benzyl)-2-methyl-malonic acid
- Propanedioic acid, 2-[(4-bromophenyl)methyl]-2-methyl-
- 2-[(4-Bromophenyl)methyl]-2-methylpropanedioic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.