CymitQuimica logo

CAS 1253791-85-3

:

7-Methyl-1-(2-propyn-1-yl)-2H-pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione

Description:
7-Methyl-1-(2-propyn-1-yl)-2H-pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione is a chemical compound characterized by its complex bicyclic structure, which includes a pyridine and an oxazine moiety. This compound features a methyl group and a propynyl substituent, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the oxazine ring suggests that it may exhibit interesting electronic properties, potentially influencing its behavior in chemical reactions. Additionally, the compound's structure may allow for various interactions with biological targets, making it a candidate for further investigation in drug development. Its CAS number, 1253791-85-3, facilitates its identification in chemical databases and literature. As with many organic compounds, its solubility, stability, and reactivity will depend on the specific conditions, such as solvent and temperature. Overall, this compound represents a fascinating area of study within the field of organic chemistry, particularly in the context of heterocyclic compounds.
Formula:C11H8N2O3
InChI:InChI=1S/C11H8N2O3/c1-3-6-13-9-8(5-4-7(2)12-9)10(14)16-11(13)15/h1,4-5H,6H2,2H3
InChI key:InChIKey=ZBNVJFQOPMHBMY-UHFFFAOYSA-N
SMILES:C(C#C)N1C=2C(C(=O)OC1=O)=CC=C(C)N2
Synonyms:
  • 7-Methyl-1-(2-propyn-1-yl)-2H-pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione
  • 2H-Pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione, 7-methyl-1-(2-propyn-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.