CAS 1253792-10-7

5-Bromo-7-fluoro-2,3-dihydro-3,3-dimethyl-1H-isoindol-1-one

Description:

5-Bromo-7-fluoro-2,3-dihydro-3,3-dimethyl-1H-isoindol-1-one is a chemical compound characterized by its unique isoindole structure, which features a bicyclic framework. The presence of bromine and fluorine substituents introduces significant electronegativity and steric effects, influencing the compound's reactivity and potential applications in medicinal chemistry. The dihydro form indicates that the compound has a saturated ring system, which may contribute to its stability and solubility in various solvents. The dimethyl groups enhance the steric bulk around the nitrogen atom, potentially affecting its interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its CAS number, 1253792-10-7, allows for easy identification and retrieval of information in chemical databases. Overall, the combination of halogen substituents and the isoindole core suggests that this compound could be of interest in the synthesis of novel therapeutic agents.

Formula: C₁₀H₉BrFNO

InChI: InChI=1S/C10H9BrFNO/c1-10(2)6-3-5(11)4-7(12)8(6)9(14)13-10/h3-4H,1-2H3,(H,13,14)

InChI key: InChIKey=HHGWAFIYZHZTSE-UHFFFAOYSA-N

SMILES: CC1(C)C=2C(C(=O)N1)=C(F)C=C(Br)C2

Synonyms:

• 5-Bromo-7-fluoro-2,3-dihydro-3,3-dimethyl-1H-isoindol-1-one
• 1H-Isoindol-1-one, 5-bromo-7-fluoro-2,3-dihydro-3,3-dimethyl-