CAS 1253792-22-1

2-Amino-3,4-dichlorobenzenemethanamine

Description:

2-Amino-3,4-dichlorobenzenemethanamine, identified by its CAS number 1253792-22-1, is an organic compound characterized by the presence of an amino group and a dichlorobenzene moiety. This compound features a benzene ring substituted with two chlorine atoms at the 3 and 4 positions, along with an amino group attached to a methanamine structure. The presence of chlorine atoms contributes to its reactivity and potential applications in various chemical syntheses. The amino group imparts basic properties, allowing it to participate in various reactions, including nucleophilic substitutions and coupling reactions. This compound may exhibit moderate to high solubility in polar solvents due to the amino group, while its chlorinated structure may influence its hydrophobicity. Additionally, the compound's potential biological activity and toxicity should be evaluated, as chlorinated aromatic amines can sometimes exhibit harmful effects. Overall, 2-Amino-3,4-dichlorobenzenemethanamine is of interest in both synthetic organic chemistry and potential pharmaceutical applications.

Formula: C₇H₈Cl₂N₂

InChI: InChI=1S/C7H8Cl2N2/c8-5-2-1-4(3-10)7(11)6(5)9/h1-2H,3,10-11H2

InChI key: InChIKey=BJMJGAYBJKMOPP-UHFFFAOYSA-N

SMILES: C(N)C1=C(N)C(Cl)=C(Cl)C=C1

Synonyms:

• 2-Amino-3,4-dichlorobenzenemethanamine
• Benzenemethanamine, 2-amino-3,4-dichloro-
• 6-Aminomethyl-2,3-dichloro-phenylamine