CymitQuimica logo

CAS 1253792-57-2

:

Methyl5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylatehydrochloride

Description:
Methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate hydrochloride is a chemical compound characterized by its complex bicyclic structure, which includes a naphthyridine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and methanol, owing to the presence of the carboxylate group and the hydrochloride salt form. The presence of the tetrahydro configuration indicates that it has undergone partial hydrogenation, contributing to its stability and reactivity. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various biological pathways. The hydrochloride salt form enhances its solubility and bioavailability, which is crucial for therapeutic applications. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.
Formula:C10H13ClN2O2
InChI:InChI=1S/C10H12N2O2.ClH/c1-14-10(13)8-4-7-2-3-11-6-9(7)12-5-8;/h4-5,11H,2-3,6H2,1H3;1H
InChI key:PUXNZPFRFJIUCF-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC2=C(CNCC2)N=C1.Cl
Found 4 products.