CAS 1253792-94-7

D-Proline, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester, hydrochloride (1:1), (4S)-rel-

Description:

D-Proline, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester, hydrochloride (1:1), (4S)-rel- is a synthetic amino acid derivative characterized by its proline backbone, which is a cyclic, non-polar amino acid known for its role in protein structure and function. This compound features a dimethylethoxycarbonyl group that enhances its stability and solubility, making it suitable for various biochemical applications. The methyl ester form indicates that the carboxylic acid group is esterified, which can influence its reactivity and bioavailability. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in biological systems. The (4S)-configuration denotes its specific stereochemistry, which is crucial for its biological activity. This compound may be utilized in peptide synthesis, drug development, and as a building block in organic chemistry due to its unique structural properties. Its CAS number, 1253792-94-7, allows for precise identification in chemical databases and regulatory contexts.

Formula: C₁₁H₂₀N₂O₄·ClH

InChI: InChI=1/C11H20N2O4.ClH/c1-11(2,3)17-10(15)13-7-5-8(12-6-7)9(14)16-4;/h7-8,12H,5-6H2,1-4H3,(H,13,15);1H/t7-,8+;/s2

InChI key: InChIKey=KJYYJRIAHJXTNC-NDHVLLJLNA-N

SMILES: N(C(OC(C)(C)C)=O)[C@H]1C[C@H](C(OC)=O)NC1.Cl

Synonyms:

• D-Proline, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, methyl ester, hydrochloride (1:1), (4S)-rel-