CymitQuimica logo

CAS 1253856-42-6

:

1,2-Bis(1,1-dimethylethyl) (2S,5S)-5-hydroxy-1,2-piperidinedicarboxylate

Description:
1,2-Bis(1,1-dimethylethyl) (2S,5S)-5-hydroxy-1,2-piperidinedicarboxylate, identified by its CAS number 1253856-42-6, is a chemical compound characterized by its piperidine structure, which includes two carboxylate functional groups and a hydroxyl group. The presence of the bulky 1,1-dimethylethyl groups contributes to its steric hindrance, influencing its reactivity and interactions with other molecules. This compound is likely to exhibit properties typical of piperidine derivatives, such as potential biological activity, which may include roles in medicinal chemistry or as intermediates in organic synthesis. The specific stereochemistry indicated by the (2S,5S) configuration suggests that it may have distinct chiral properties, which can affect its pharmacological profile. Additionally, the presence of multiple functional groups may enhance its solubility in various solvents, making it versatile for different applications in research and industry. Overall, this compound's unique structure and functional groups position it as a potentially interesting subject for further study in chemical and pharmaceutical contexts.
Formula:C15H27NO5
InChI:InChI=1S/C15H27NO5/c1-14(2,3)20-12(18)11-8-7-10(17)9-16(11)13(19)21-15(4,5)6/h10-11,17H,7-9H2,1-6H3/t10-,11-/m0/s1
InChI key:InChIKey=JQJWQBUZYXWGTH-QWRGUYRKSA-N
SMILES:C(OC(C)(C)C)(=O)[C@H]1N(C(OC(C)(C)C)=O)C[C@@H](O)CC1
Synonyms:
  • 1,2-Bis(1,1-dimethylethyl) (2S,5S)-5-hydroxy-1,2-piperidinedicarboxylate
  • 1,2-Piperidinedicarboxylic acid, 5-hydroxy-, 1,2-bis(1,1-dimethylethyl) ester, (2S,5S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.