CAS 1253888-80-0
:Methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate
Description:
Methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a naphthyridine moiety. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the ring system, contributing to its stability and reactivity. The carboxylate functional group, derived from the carboxylic acid, suggests potential for various chemical reactions, including esterification and nucleophilic substitution. The methyl ester group enhances its solubility in organic solvents, making it useful in synthetic applications. Additionally, the compound may exhibit biological activity, as many naphthyridine derivatives are known for their pharmacological properties. Its molecular structure allows for potential interactions with biological targets, which could be explored in medicinal chemistry. Overall, Methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate is a versatile compound with implications in both synthetic and medicinal chemistry.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c1-14-10(13)8-4-7-2-3-11-6-9(7)12-5-8/h4-5,11H,2-3,6H2,1H3
InChI key:InChIKey=RWKGYDMSJZUVNO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C2C(=NC1)CNCC2
Synonyms:- 1,7-Naphthyridine-3-carboxylic acid, 5,6,7,8-tetrahydro-, methyl ester
- Methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate
- 5,6,7,8-Tetrahydro-[1,7]naphthyridine-3-carboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 5,6,7,8-tetrahydro-1,7-naphthyridine-3-carboxylate
CAS:Formula:C10H12N2O2Molecular weight:192.2145
