CAS 125392-76-9
:(6′R)-6′-Hydroxy-2′,4′,6′-trimethylspiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one
Description:
(6′R)-6′-Hydroxy-2′,4′,6′-trimethylspiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, with CAS number 125392-76-9, is a complex organic compound characterized by its unique spirocyclic structure, which features a cyclopropane ring fused to an indene moiety. This compound exhibits a hydroxyl functional group at the 6′ position, contributing to its potential reactivity and solubility in various solvents. The presence of multiple methyl groups enhances its hydrophobic characteristics, influencing its interaction with biological systems and other chemical entities. The stereochemistry indicated by the (6′R) designation suggests specific spatial arrangements of atoms, which can significantly affect the compound's biological activity and chemical behavior. Such compounds are often of interest in medicinal chemistry and organic synthesis due to their structural complexity and potential applications in pharmaceuticals or agrochemicals. Overall, the unique structural features and functional groups of this compound make it a subject of interest for further research and development in various chemical fields.
Formula:C14H16O2
InChI:InChI=1S/C14H16O2/c1-8-6-10-9(2)14(4-5-14)13(3,16)12(15)11(10)7-8/h6-7,16H,4-5H2,1-3H3/t13-/m0/s1
InChI key:InChIKey=HLAKJNQXUARACO-ZDUSSCGKSA-N
SMILES:CC=1C2([C@@](C)(O)C(=O)C=3C1C=C(C)C3)CC2
Synonyms:- (6′R)-6′-Hydroxy-2′,4′,6′-trimethylspiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one
- Spiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, 6′-hydroxy-2′,4′,6′-trimethyl-, (6′R)-
- Acylfulvene
- Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one,6'-hydroxy-2',4',6'-trimethyl-, (R)-
- Spiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, 6′-hydroxy-2′,4′,6′-trimethyl-, (R)-
- Illudofulvene
- Acylfulvene
- (-)-Acylfulvene
- Illudofulvene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(-)-Acylfulvene
CAS:(-)-Acylfulvene is an analog of the natural product xylan, which has been shown to induce apoptosis in cancer cells. It is a potent inhibitor of protein kinases and has demonstrated anticancer activity in vitro and in vivo. (-)-Acylfulvene has been found to be effective against a wide range of human cancers, including tumors of the breast, lung, colon, and prostate. This compound has also been studied as a potential treatment for urinary bladder cancer due to its ability to inhibit the growth of cancer cells. As a promising class of anticancer agents, (-)-Acylfulvene and its derivatives are being investigated as kinase inhibitors and tumor growth inhibitors with potential therapeutic applications in cancer treatment.Formula:C14H16O2Purity:Min. 95%Molecular weight:216.27 g/mol
