CAS 125392-76-9: (6′R)-6′-Hydroxy-2′,4′,6′-trimethylspiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one
Description:(6′R)-6′-Hydroxy-2′,4′,6′-trimethylspiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, with CAS number 125392-76-9, is a complex organic compound characterized by its unique spirocyclic structure, which features a cyclopropane ring fused to an indene moiety. This compound exhibits a hydroxyl functional group at the 6′ position, contributing to its potential reactivity and solubility in various solvents. The presence of multiple methyl groups enhances its hydrophobic characteristics, influencing its interaction with biological systems and other chemical entities. The stereochemistry indicated by the (6′R) designation suggests specific spatial arrangements of atoms, which can significantly affect the compound's biological activity and chemical behavior. Such compounds are often of interest in medicinal chemistry and organic synthesis due to their structural complexity and potential applications in pharmaceuticals or agrochemicals. Overall, the unique structural features and functional groups of this compound make it a subject of interest for further research and development in various chemical fields.
Formula:C14H16O2
InChI:InChI=1S/C14H16O2/c1-8-6-10-9(2)14(4-5-14)13(3,16)12(15)11(10)7-8/h6-7,16H,4-5H2,1-3H3/t13-/m0/s1
InChI key:InChIKey=HLAKJNQXUARACO-ZDUSSCGKSA-N
SMILES:O=C1C2=CC(=CC2=C(C)C3(CC3)C1(O)C)C
- Synonyms:
- (6′R)-6′-Hydroxy-2′,4′,6′-trimethylspiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one
- Spiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, 6′-hydroxy-2′,4′,6′-trimethyl-, (6′R)-
- Acylfulvene
- Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one,6'-hydroxy-2',4',6'-trimethyl-, (R)-
- Spiro[cyclopropane-1,5′-[5H]inden]-7′(6′H)-one, 6′-hydroxy-2′,4′,6′-trimethyl-, (R)-
- Illudofulvene
- Acylfulvene
- (-)-Acylfulvene
- Illudofulvene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (-)-Acylfulvene REF: 3D-AFA39276CAS: 125392-76-9 | Min. 95% | To inquire | Tue 15 Apr 25 |

(-)-Acylfulvene
Ref: 3D-AFA39276
5mg | 1,709.00 € | ||
10mg | 2,734.00 € | ||
25mg | 5,126.00 € | ||
50mg | 8,202.00 € |