CAS 1253927-28-4

4-Bromo-N,3,5-trimethylbenzenamine

Description:

4-Bromo-N,3,5-trimethylbenzenamine, also known as a substituted aniline, is an organic compound characterized by the presence of a bromine atom and three methyl groups attached to a benzene ring, along with an amino group (-NH2). This compound features a bromine substituent at the para position relative to the amino group, while the three methyl groups are located at the 3, 5, and 4 positions of the benzene ring. The presence of these substituents influences its physical and chemical properties, such as solubility, reactivity, and boiling point. Typically, compounds of this nature exhibit moderate to high reactivity due to the amino group, which can participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic reactions. Additionally, the bromine atom can serve as a leaving group in substitution reactions. The compound may also exhibit specific biological activities, making it of interest in pharmaceutical and agrochemical research. Safety data should be consulted for handling and potential hazards associated with this substance.

Formula: C₉H₁₂BrN

InChI: InChI=1S/C9H12BrN/c1-6-4-8(11-3)5-7(2)9(6)10/h4-5,11H,1-3H3

InChI key: InChIKey=JVRPQJRDBRZUPS-UHFFFAOYSA-N

SMILES: N(C)C1=CC(C)=C(Br)C(C)=C1

Synonyms:

• Benzenamine, 4-bromo-N,3,5-trimethyl-
• 4-Bromo-N,3,5-trimethylbenzenamine