CAS 1254053-43-4: 6-Ethyl-3-[[3-methoxy-4-[4-(4-methyl-1-piperazinyl)-1-piperidinyl]phenyl]amino]-5-[(tetrahydro-2H-pyran-4-yl)amino]-2-pyrazinecarboxamide
Description:6-Ethyl-3-[[3-methoxy-4-[4-(4-methyl-1-piperazinyl)-1-piperidinyl]phenyl]amino]-5-[(tetrahydro-2H-pyran-4-yl)amino]-2-pyrazinecarboxamide, with CAS number 1254053-43-4, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as amines, methoxy, and a pyrazine ring. This compound is notable for its potential pharmacological properties, often explored in the context of medicinal chemistry and drug development. The presence of piperazine and piperidine moieties suggests possible interactions with biological targets, particularly in the central nervous system. Its solubility and stability can vary based on the specific conditions, such as pH and temperature, which are critical for its application in biological assays. Additionally, the compound's molecular weight and specific stereochemistry can influence its biological activity and pharmacokinetics. As with many complex organic molecules, thorough characterization through techniques like NMR, mass spectrometry, and crystallography is essential for understanding its properties and potential uses in therapeutic contexts.
Formula:C29H44N8O3
InChI:InChI=1S/C29H44N8O3/c1-4-23-28(31-20-9-17-40-18-10-20)34-29(26(33-23)27(30)38)32-21-5-6-24(25(19-21)39-3)37-11-7-22(8-12-37)36-15-13-35(2)14-16-36/h5-6,19-20,22H,4,7-18H2,1-3H3,(H2,30,38)(H2,31,32,34)
InChI key:InChIKey=GYQYAJJFPNQOOW-UHFFFAOYSA-N
SMILES:O=C(N)C=1N=C(C(=NC1NC2=CC=C(C(OC)=C2)N3CCC(N4CCN(C)CC4)CC3)NC5CCOCC5)CC
- Synonyms:
- Gilteritinib
- 2-Pyrazinecarboxamide, 6-ethyl-3-[[3-methoxy-4-[4-(4-methyl-1-piperazinyl)-1-piperidinyl]phenyl]amino]-5-[(tetrahydro-2H-pyran-4-yl)amino]-
- 6-Ethyl-3-[[3-methoxy-4-[4-(4-methyl-1-piperazinyl)-1-piperidinyl]phenyl]amino]-5-[(tetrahydro-2H-pyran-4-yl)amino]-2-pyrazinecarboxamide
- ASP 2215