CymitQuimica logo

CAS 1254062-62-8

:

1-(Bromomethyl)-4-ethoxy-2-methylbenzene

Description:
1-(Bromomethyl)-4-ethoxy-2-methylbenzene, identified by its CAS number 1254062-62-8, is an organic compound characterized by a bromomethyl group attached to a benzene ring that also features an ethoxy group and a methyl substituent. This compound belongs to the class of substituted aromatic hydrocarbons, which are known for their diverse chemical reactivity and applications in organic synthesis. The presence of the bromomethyl group makes it a potential electrophile, allowing it to participate in nucleophilic substitution reactions. The ethoxy group contributes to the compound's solubility in organic solvents and can influence its reactivity and stability. Additionally, the methyl group on the benzene ring can affect the electronic properties of the molecule, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Overall, this compound's unique structure and functional groups make it a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C10H13BrO
InChI:InChI=1S/C10H13BrO/c1-3-12-10-5-4-9(7-11)8(2)6-10/h4-6H,3,7H2,1-2H3
InChI key:InChIKey=VKJWDKANHGNSSR-UHFFFAOYSA-N
SMILES:O(CC)C1=CC(C)=C(CBr)C=C1
Synonyms:
  • 1-(Bromomethyl)-4-ethoxy-2-methylbenzene
  • Benzene, 1-(bromomethyl)-4-ethoxy-2-methyl-
  • 1-Bromomethyl-4-ethoxy-2-methylbenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.