CAS 125411-62-3
:Proline, 1-(aminocarbonyl)- (9CI)
Description:
Proline, 1-(aminocarbonyl)-, also known as 5-oxoproline or pyroglutamic acid, is an amino acid derivative characterized by its unique structure that includes a pyrrolidine ring and a carboxamide functional group. This compound is notable for its role in various biochemical processes, particularly in protein synthesis and metabolism. It is classified as a non-essential amino acid, meaning that it can be synthesized by the body. The presence of the carbonyl group contributes to its reactivity and potential interactions in biochemical pathways. Proline, 1-(aminocarbonyl)- is soluble in water, which facilitates its biological functions. It is often studied for its implications in neurochemistry and its potential role in modulating oxidative stress. Additionally, this compound may have applications in pharmaceuticals and nutraceuticals, particularly in formulations aimed at enhancing cognitive function or supporting metabolic health. Its CAS number, 125411-62-3, is a unique identifier that aids in the cataloging and regulation of chemical substances.
Formula:C6H10N2O3
InChI:InChI=1/C6H10N2O3/c7-6(11)8-3-1-2-4(8)5(9)10/h4H,1-3H2,(H2,7,11)(H,9,10)
SMILES:C1CC(C(=O)O)N(C1)C(=N)O
Synonyms:- 1-Carbamoyl-pyrrolidine-2-carboxylic acid
- 1-Carbamoylproline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-carbamoylpyrrolidine-2-carboxylic acid
CAS:1-Carbamoylpyrrolidine-2-carboxylic acid is an antimicrobial agent that belongs to the class of cyclic amino acid derivatives. It crystallizes well and has a high yield of approximately 91%. The antimicrobial activity of 1-carbamoylpyrrolidine-2-carboxylic acid is due to its ability to inhibit microbial cell parameters, such as axial rotation and hydrolysis. This compound also has the ability to bind to benzyl groups with a high affinity and inhibit microbial growth by interfering with protein synthesis. Furthermore, 1-carbamoylpyrrolidine-2-carboxylic acid is inexpensively synthesized from benzoic acid.
Formula:C6H10N2O3Purity:Min. 95%Molecular weight:158.16 g/molRef: 3D-AFA41162
Discontinued product


