CAS 1254118-45-0

B-[4-(1,1,2,2-Tetrafluoroethoxy)phenyl]boronic acid

Description:

B-[4-(1,1,2,2-Tetrafluoroethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a tetrafluoroethoxy group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the tetrafluoroethoxy group enhances its lipophilicity and may influence its reactivity and solubility in organic solvents. Additionally, the fluorinated moiety can impart unique electronic properties, potentially affecting the compound's behavior in chemical reactions and interactions with biological systems. Overall, this compound is of interest in the development of pharmaceuticals and materials science due to its distinctive structural features and reactivity profile.

Formula: C₈H₇BF₄O₃

InChI: InChI=1S/C8H7BF4O3/c10-7(11)8(12,13)16-6-3-1-5(2-4-6)9(14)15/h1-4,7,14-15H

InChI key: InChIKey=OKKRVUWOVACPCA-UHFFFAOYSA-N

SMILES: O(C(C(F)F)(F)F)C1=CC=C(B(O)O)C=C1

Synonyms:

• 4-(1,1,2,2-Tetrafluoroethoxy)phenylboronic acid
• B-[4-(1,1,2,2-Tetrafluoroethoxy)phenyl]boronic acid
• Boronic acid, B-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-

[4-(1,1,2,2-tetrafluoroethoxy)phenyl]boronic acid

CAS: 1254118-45-0

Formula: C₈H₇BF₄O₃

Molecular weight: 237.9440

Ref: IN-DA01JOI1

4-(1,1,2,2-Tetrafluoroethoxy)benzeneboronic acid

CAS: 1254118-45-0

4-(1,1,2,2-Tetrafluoroethoxy)benzeneboronic acid

Purity: 95%

Color and Shape: White Solid

Molecular weight: 237.94g/mol

Ref: 54-PC48961