CAS 1254123-86-8

6-Bromo-N-(1-methylethyl)-3-pyridinecarboxamide

Description:

6-Bromo-N-(1-methylethyl)-3-pyridinecarboxamide is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position of the pyridine ring introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The N-(1-methylethyl) group, also known as an isopropyl group, is attached to the nitrogen atom of the amide functional group, contributing to the compound's steric and electronic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its amide functional group suggests potential for hydrogen bonding, which can affect solubility and interaction with biological targets. The molecular structure and substituents can also influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Overall, 6-Bromo-N-(1-methylethyl)-3-pyridinecarboxamide is a compound with specific structural features that may confer unique chemical and biological properties.

Formula: C₉H₁₁BrN₂O

InChI: InChI=1S/C9H11BrN2O/c1-6(2)12-9(13)7-3-4-8(10)11-5-7/h3-6H,1-2H3,(H,12,13)

InChI key: InChIKey=CNMAYTJHGDDWIE-UHFFFAOYSA-N

SMILES: C(NC(C)C)(=O)C=1C=CC(Br)=NC1

Synonyms:

• 3-Pyridinecarboxamide, 6-bromo-N-(1-methylethyl)-
• 6-Bromo-N-(1-methylethyl)-3-pyridinecarboxamide